C14H18Cl2O2 — CID 58488980
ethyl 4-(2,3-dichlorophenyl)-2,2-dimethylbutanoate (PubChem CID 58488980) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is ethyl 4-(2,3-dichlorophenyl)-2,2-dimethylbutanoate.
| Compound Name | ethyl 4-(2,3-dichlorophenyl)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58488980 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | ethyl 4-(2,3-dichlorophenyl)-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)CCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H18Cl2O2/c1-4-18-13(17)14(2,3)9-8-10-6-5-7-11(15)12(10)16/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | IDHTXRKPDZRUSX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |