C10H8Cl2F2O — CID 130757125
1-(2,3-dichlorophenyl)-3,3-difluorobutan-2-one (PubChem CID 130757125) has the molecular formula C10H8Cl2F2O and a molecular weight of 253.07 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3,3-difluorobutan-2-one.
| Compound Name | 1-(2,3-dichlorophenyl)-3,3-difluorobutan-2-one |
|---|---|
| PubChem CID | 130757125 |
| Molecular Formula | C10H8Cl2F2O |
| Molecular Weight | 253.07 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3,3-difluorobutan-2-one |
| SMILES | CC(F)(F)C(=O)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H8Cl2F2O/c1-10(13,14)8(15)5-6-3-2-4-7(11)9(6)12/h2-4H,5H2,1H3 |
| InChIKey | LVXFHFQPWJQWNP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.07 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |