C13H16Cl2O2 — CID 107308023
1-(2,3-dichlorophenyl)-3-ethoxypentan-2-one (PubChem CID 107308023) has the molecular formula C13H16Cl2O2 and a molecular weight of 275.17 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-ethoxypentan-2-one.
| Compound Name | 1-(2,3-dichlorophenyl)-3-ethoxypentan-2-one |
|---|---|
| PubChem CID | 107308023 |
| Molecular Formula | C13H16Cl2O2 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-ethoxypentan-2-one |
| SMILES | CCOC(CC)C(=O)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2O2/c1-3-12(17-4-2)11(16)8-9-6-5-7-10(14)13(9)15/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | OFNQHRFAAAYELI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |