C17H22Cl2O2 — CID 107308047
1-cyclohexyl-3-(2,3-dichlorophenyl)-1-ethoxypropan-2-one (PubChem CID 107308047) has the molecular formula C17H22Cl2O2 and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-ethoxypropan-2-one.
| Compound Name | 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-ethoxypropan-2-one |
|---|---|
| PubChem CID | 107308047 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-cyclohexyl-3-(2,3-dichlorophenyl)-1-ethoxypropan-2-one |
| SMILES | CCOC(C(=O)Cc1cccc(Cl)c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-2-21-17(12-7-4-3-5-8-12)15(20)11-13-9-6-10-14(18)16(13)19/h6,9-10,12,17H,2-5,7-8,11H2,1H3 |
| InChIKey | JNLKECSJHGCSRU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |