C18H26O2 — CID 116751104
1-cyclohexyl-3-(2,6-dimethylphenyl)-1-methoxypropan-2-one (PubChem CID 116751104) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,6-dimethylphenyl)-1-methoxypropan-2-one.
| Compound Name | 1-cyclohexyl-3-(2,6-dimethylphenyl)-1-methoxypropan-2-one |
|---|---|
| PubChem CID | 116751104 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-cyclohexyl-3-(2,6-dimethylphenyl)-1-methoxypropan-2-one |
| SMILES | COC(C(=O)Cc1c(C)cccc1C)C1CCCCC1 |
| InChI | InChI=1S/C18H26O2/c1-13-8-7-9-14(2)16(13)12-17(19)18(20-3)15-10-5-4-6-11-15/h7-9,15,18H,4-6,10-12H2,1-3H3 |
| InChIKey | GGCIEPPBBSCKIT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |