C14H17FO2 — CID 114347373
1-cyclopropyl-3-(4-fluoro-2-methylphenyl)-1-methoxypropan-2-one (PubChem CID 114347373) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 1-cyclopropyl-3-(4-fluoro-2-methylphenyl)-1-methoxypropan-2-one.
| Compound Name | 1-cyclopropyl-3-(4-fluoro-2-methylphenyl)-1-methoxypropan-2-one |
|---|---|
| PubChem CID | 114347373 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-cyclopropyl-3-(4-fluoro-2-methylphenyl)-1-methoxypropan-2-one |
| SMILES | COC(C(=O)Cc1ccc(F)cc1C)C1CC1 |
| InChI | InChI=1S/C14H17FO2/c1-9-7-12(15)6-5-11(9)8-13(16)14(17-2)10-3-4-10/h5-7,10,14H,3-4,8H2,1-2H3 |
| InChIKey | OUDHNZTVTQUKEH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |