C16H20BrFO2 — CID 116750878
3-(2-bromo-5-fluorophenyl)-1-cyclohexyl-1-methoxypropan-2-one (PubChem CID 116750878) has the molecular formula C16H20BrFO2 and a molecular weight of 343.24 g/mol. Its IUPAC name is 3-(2-bromo-5-fluorophenyl)-1-cyclohexyl-1-methoxypropan-2-one.
| Compound Name | 3-(2-bromo-5-fluorophenyl)-1-cyclohexyl-1-methoxypropan-2-one |
|---|---|
| PubChem CID | 116750878 |
| Molecular Formula | C16H20BrFO2 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-(2-bromo-5-fluorophenyl)-1-cyclohexyl-1-methoxypropan-2-one |
| SMILES | COC(C(=O)Cc1cc(F)ccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C16H20BrFO2/c1-20-16(11-5-3-2-4-6-11)15(19)10-12-9-13(18)7-8-14(12)17/h7-9,11,16H,2-6,10H2,1H3 |
| InChIKey | FPJARNVCURJCNE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |