C13H14ClFO2 — CID 102617821
3-(2-chloro-5-fluorophenyl)-1-cyclopropyl-1-methoxypropan-2-one (PubChem CID 102617821) has the molecular formula C13H14ClFO2 and a molecular weight of 256.70 g/mol. Its IUPAC name is 3-(2-chloro-5-fluorophenyl)-1-cyclopropyl-1-methoxypropan-2-one.
| Compound Name | 3-(2-chloro-5-fluorophenyl)-1-cyclopropyl-1-methoxypropan-2-one |
|---|---|
| PubChem CID | 102617821 |
| Molecular Formula | C13H14ClFO2 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(2-chloro-5-fluorophenyl)-1-cyclopropyl-1-methoxypropan-2-one |
| SMILES | COC(C(=O)Cc1cc(F)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C13H14ClFO2/c1-17-13(8-2-3-8)12(16)7-9-6-10(15)4-5-11(9)14/h4-6,8,13H,2-3,7H2,1H3 |
| InChIKey | OMCOVKIEIVVYML-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |