C16H28O2 — CID 70193866
1,2-dicyclohexyl-2-ethoxyethanone (PubChem CID 70193866) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,2-dicyclohexyl-2-ethoxyethanone.
| Compound Name | 1,2-dicyclohexyl-2-ethoxyethanone |
|---|---|
| PubChem CID | 70193866 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1,2-dicyclohexyl-2-ethoxyethanone |
| SMILES | CCOC(C(=O)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H28O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h13-14,16H,2-12H2,1H3 |
| InChIKey | KAJRAXVKKNBOGJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |