About 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine
1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine (PubChem CID 63476982) has the molecular formula C16H23Cl2N
and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine |
| PubChem CID | 63476982 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine |
| SMILES | CCC(NCc1cccc(Cl)c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H23Cl2N/c1-2-15(12-7-4-3-5-8-12)19-11-13-9-6-10-14(17)16(13)18/h6,9-10,12,15,19H,2-5,7-8,11H2,1H3 |
| InChIKey | RARXQESLJUUVBK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine?
The IUPAC name of 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine (CID 63476982) is 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine.
What is the SMILES notation for 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine?
The canonical SMILES for 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine is CCC(NCc1cccc(Cl)c1Cl)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine?
The InChIKey is RARXQESLJUUVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2N/c1-2-15(12-7-4-3-5-8-12)19-11-13-9-6-10-14(17)16(13)18/h6,9-10,12,15,19H,2-5,7-8,11H2,1H3.
What are the key properties of 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine?
1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine has a molecular weight of 300.27 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-[(2,3-dichlorophenyl)methyl]propan-1-amine is sourced from PubChem (CID 63476982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).