C18H27NO2 — CID 62406452
methyl 2-[(1-cyclohexylpropylamino)methyl]benzoate (PubChem CID 62406452) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is methyl 2-[(1-cyclohexylpropylamino)methyl]benzoate.
| Compound Name | methyl 2-[(1-cyclohexylpropylamino)methyl]benzoate |
|---|---|
| PubChem CID | 62406452 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | methyl 2-[(1-cyclohexylpropylamino)methyl]benzoate |
| SMILES | CCC(NCc1ccccc1C(=O)OC)C1CCCCC1 |
| InChI | InChI=1S/C18H27NO2/c1-3-17(14-9-5-4-6-10-14)19-13-15-11-7-8-12-16(15)18(20)21-2/h7-8,11-12,14,17,19H,3-6,9-10,13H2,1-2H3 |
| InChIKey | UFIAWFPDCBSUBG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |