C19H28O2 — CID 116751194
2-cyclohexyl-2-ethoxy-1-(3-propylphenyl)ethanone (PubChem CID 116751194) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-cyclohexyl-2-ethoxy-1-(3-propylphenyl)ethanone.
| Compound Name | 2-cyclohexyl-2-ethoxy-1-(3-propylphenyl)ethanone |
|---|---|
| PubChem CID | 116751194 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-cyclohexyl-2-ethoxy-1-(3-propylphenyl)ethanone |
| SMILES | CCCc1cccc(C(=O)C(OCC)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H28O2/c1-3-9-15-10-8-13-17(14-15)18(20)19(21-4-2)16-11-6-5-7-12-16/h8,10,13-14,16,19H,3-7,9,11-12H2,1-2H3 |
| InChIKey | IQWHEPJWUGSDSZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |