C13H15ClO3 — CID 22664966
ethyl 3-(2-chlorophenyl)-2,2-dimethyl-3-oxopropanoate (PubChem CID 22664966) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-2,2-dimethyl-3-oxopropanoate.
| Compound Name | ethyl 3-(2-chlorophenyl)-2,2-dimethyl-3-oxopropanoate |
|---|---|
| PubChem CID | 22664966 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-2,2-dimethyl-3-oxopropanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H15ClO3/c1-4-17-12(16)13(2,3)11(15)9-7-5-6-8-10(9)14/h5-8H,4H2,1-3H3 |
| InChIKey | ZAWLJUXRNXZTIJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|