C15H19ClO3S — CID 103289000
ethyl 4-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethyl-3-oxobutanoate (PubChem CID 103289000) has the molecular formula C15H19ClO3S and a molecular weight of 314.83 g/mol. Its IUPAC name is ethyl 4-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 103289000 |
| Molecular Formula | C15H19ClO3S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl 4-[(2-chlorophenyl)methylsulfanyl]-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C15H19ClO3S/c1-4-19-14(18)15(2,3)13(17)10-20-9-11-7-5-6-8-12(11)16/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | SKBUWAVPRZHUOH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|