C17H21ClN2O3S — CID 6117341
ethyl (2E)-2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]cyclopentane-1-carboxylate (PubChem CID 6117341) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is ethyl (2E)-2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]cyclopentane-1-carboxylate.
| Compound Name | ethyl (2E)-2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 6117341 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl (2E)-2-[[2-[(2-chlorophenyl)methylsulfanyl]acetyl]hydrazinylidene]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC/C1=N\NC(=O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN2O3S/c1-2-23-17(22)13-7-5-9-15(13)19-20-16(21)11-24-10-12-6-3-4-8-14(12)18/h3-4,6,8,13H,2,5,7,9-11H2,1H3,(H,20,21)/b19-15+ |
| InChIKey | QEFOOWYKYUNHSF-XDJHFCHBSA-N |
| XLogP | 3.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|