C28H35ClO6 — CID 166446466
diethyl 2-(2-chlorobenzoyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate (PubChem CID 166446466) has the molecular formula C28H35ClO6 and a molecular weight of 503.04 g/mol. Its IUPAC name is diethyl 2-(2-chlorobenzoyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate.
| Compound Name | diethyl 2-(2-chlorobenzoyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate |
|---|---|
| PubChem CID | 166446466 |
| Molecular Formula | C28H35ClO6 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | diethyl 2-(2-chlorobenzoyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C(=O)c1ccccc1Cl)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H35ClO6/c1-9-34-24(32)28(25(33)35-10-2,23(31)18-13-11-12-14-21(18)29)17-15-19(26(3,4)5)22(30)20(16-17)27(6,7)8/h11-16,30H,9-10H2,1-8H3 |
| InChIKey | KTMGICLWPFXFCE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|