C21H26ClNO2 — CID 56697988
2-chloro-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzamide (PubChem CID 56697988) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is 2-chloro-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzamide.
| Compound Name | 2-chloro-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 56697988 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-chloro-N-(3,5-ditert-butyl-4-hydroxyphenyl)benzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccccc2Cl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H26ClNO2/c1-20(2,3)15-11-13(12-16(18(15)24)21(4,5)6)23-19(25)14-9-7-8-10-17(14)22/h7-12,24H,1-6H3,(H,23,25) |
| InChIKey | BZRLZRSTLAENGX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|