C19H25NO3 — CID 56689935
N-(3,5-ditert-butyl-4-hydroxyphenyl)furan-2-carboxamide (PubChem CID 56689935) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)furan-2-carboxamide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 56689935 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)furan-2-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccco2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H25NO3/c1-18(2,3)13-10-12(11-14(16(13)21)19(4,5)6)20-17(22)15-8-7-9-23-15/h7-11,21H,1-6H3,(H,20,22) |
| InChIKey | ZCEHBAUFSOOQNL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|