C15H13NO6 — CID 711226
dimethyl 5-(furan-2-carbonylamino)benzene-1,3-dicarboxylate (PubChem CID 711226) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is dimethyl 5-(furan-2-carbonylamino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(furan-2-carbonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 711226 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | dimethyl 5-(furan-2-carbonylamino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccco2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C15H13NO6/c1-20-14(18)9-6-10(15(19)21-2)8-11(7-9)16-13(17)12-4-3-5-22-12/h3-8H,1-2H3,(H,16,17) |
| InChIKey | DNUWDNULJNLBHH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |