C17H17NO6 — CID 26364910
dimethyl 5-[3-(furan-2-yl)propanoylamino]benzene-1,3-dicarboxylate (PubChem CID 26364910) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is dimethyl 5-[3-(furan-2-yl)propanoylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(furan-2-yl)propanoylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26364910 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | dimethyl 5-[3-(furan-2-yl)propanoylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCc2ccco2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H17NO6/c1-22-16(20)11-8-12(17(21)23-2)10-13(9-11)18-15(19)6-5-14-4-3-7-24-14/h3-4,7-10H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | UHMOUIDTZBDHMO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |