C15H8ClNO5-2 — CID 3603444
5-[(2-chlorobenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 3603444) has the molecular formula C15H8ClNO5-2 and a molecular weight of 317.68 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 5-[(2-chlorobenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3603444 |
| Molecular Formula | C15H8ClNO5-2 |
| Molecular Weight | 317.68 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cc(NC(=O)c2ccccc2Cl)cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C15H10ClNO5/c16-12-4-2-1-3-11(12)13(18)17-10-6-8(14(19)20)5-9(7-10)15(21)22/h1-7H,(H,17,18)(H,19,20)(H,21,22)/p-2 |
| InChIKey | ZTPGEDDTXTWHKF-UHFFFAOYSA-L |
| XLogP | 0.32 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.68 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |