C14H8Cl2NO3- — CID 5106258
2-[(3,4-dichlorophenyl)carbamoyl]benzoate (PubChem CID 5106258) has the molecular formula C14H8Cl2NO3- and a molecular weight of 309.13 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoyl]benzoate.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 5106258 |
| Molecular Formula | C14H8Cl2NO3- |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-11-6-5-8(7-12(11)16)17-13(18)9-3-1-2-4-10(9)14(19)20/h1-7H,(H,17,18)(H,19,20)/p-1 |
| InChIKey | IJDPTPLIVARLPT-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |