C20H14Cl2N2O3 — CID 624416
3,4-dichloro-N-[4-[(2-hydroxybenzoyl)amino]phenyl]benzamide (PubChem CID 624416) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[(2-hydroxybenzoyl)amino]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[(2-hydroxybenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 624416 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3,4-dichloro-N-[4-[(2-hydroxybenzoyl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccccc2O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-16-10-5-12(11-17(16)22)19(26)23-13-6-8-14(9-7-13)24-20(27)15-3-1-2-4-18(15)25/h1-11,25H,(H,23,26)(H,24,27) |
| InChIKey | VWWLICQSTFMAKB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |