C20H13BrCl2N2O2 — CID 21211970
N-[4-[(4-bromobenzoyl)amino]phenyl]-3,4-dichlorobenzamide (PubChem CID 21211970) has the molecular formula C20H13BrCl2N2O2 and a molecular weight of 464.15 g/mol. Its IUPAC name is N-[4-[(4-bromobenzoyl)amino]phenyl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-[(4-bromobenzoyl)amino]phenyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 21211970 |
| Molecular Formula | C20H13BrCl2N2O2 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | N-[4-[(4-bromobenzoyl)amino]phenyl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H13BrCl2N2O2/c21-14-4-1-12(2-5-14)19(26)24-15-6-8-16(9-7-15)25-20(27)13-3-10-17(22)18(23)11-13/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | UJEMBHYYIZGUBD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |