About [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite
[4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite (PubChem CID 21148482) has the molecular formula C13H9BrClNOS
and a molecular weight of 342.65 g/mol. Its IUPAC name is [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite.
Molecular Properties
| Compound Name | [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite |
| PubChem CID | 21148482 |
| Molecular Formula | C13H9BrClNOS |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 340.93 |
| IUPAC Name | [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccc(SCl)cc1 |
| InChI | InChI=1S/C13H9BrClNOS/c14-10-3-5-11(6-4-10)16-13(17)9-1-7-12(18-15)8-2-9/h1-8H,(H,16,17) |
| InChIKey | GWAVLUKMNGGSGB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite?
The IUPAC name of [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite (CID 21148482) is [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite.
What is the SMILES notation for [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite?
The canonical SMILES for [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite is O=C(Nc1ccc(Br)cc1)c1ccc(SCl)cc1.
What is the InChIKey of [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite?
The InChIKey is GWAVLUKMNGGSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrClNOS/c14-10-3-5-11(6-4-10)16-13(17)9-1-7-12(18-15)8-2-9/h1-8H,(H,16,17).
What are the key properties of [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite?
[4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite has a molecular weight of 342.65 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-bromophenyl)carbamoyl]phenyl] thiohypochlorite is sourced from PubChem (CID 21148482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).