C11H11BrCl2O2 — CID 2313836
ethyl (2R)-2-bromo-3-(2,3-dichlorophenyl)propanoate (PubChem CID 2313836) has the molecular formula C11H11BrCl2O2 and a molecular weight of 326.02 g/mol. Its IUPAC name is ethyl (2R)-2-bromo-3-(2,3-dichlorophenyl)propanoate.
| Compound Name | ethyl (2R)-2-bromo-3-(2,3-dichlorophenyl)propanoate |
|---|---|
| PubChem CID | 2313836 |
| Molecular Formula | C11H11BrCl2O2 |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | ethyl (2R)-2-bromo-3-(2,3-dichlorophenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Br)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11BrCl2O2/c1-2-16-11(15)8(12)6-7-4-3-5-9(13)10(7)14/h3-5,8H,2,6H2,1H3/t8-/m1/s1 |
| InChIKey | SIGDZXDGPOBXLP-MRVPVSSYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|