C10H9BrCl2O — CID 62394098
3-bromo-4-(2,3-dichlorophenyl)butan-2-one (PubChem CID 62394098) has the molecular formula C10H9BrCl2O and a molecular weight of 295.99 g/mol. Its IUPAC name is 3-bromo-4-(2,3-dichlorophenyl)butan-2-one.
| Compound Name | 3-bromo-4-(2,3-dichlorophenyl)butan-2-one |
|---|---|
| PubChem CID | 62394098 |
| Molecular Formula | C10H9BrCl2O |
| Molecular Weight | 295.99 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 3-bromo-4-(2,3-dichlorophenyl)butan-2-one |
| SMILES | CC(=O)C(Br)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H9BrCl2O/c1-6(14)8(11)5-7-3-2-4-9(12)10(7)13/h2-4,8H,5H2,1H3 |
| InChIKey | SCQPUPWPWCYUKB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.99 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|