C9H10Cl2S — CID 169111936
1-(2,3-dichlorophenyl)propane-2-thiol (PubChem CID 169111936) has the molecular formula C9H10Cl2S and a molecular weight of 221.15 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)propane-2-thiol.
| Compound Name | 1-(2,3-dichlorophenyl)propane-2-thiol |
|---|---|
| PubChem CID | 169111936 |
| Molecular Formula | C9H10Cl2S |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 1-(2,3-dichlorophenyl)propane-2-thiol |
| SMILES | CC(S)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H10Cl2S/c1-6(12)5-7-3-2-4-8(10)9(7)11/h2-4,6,12H,5H2,1H3 |
| InChIKey | FLUNGDLRCXBTJB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|