C15H13Cl2NO — CID 38885504
3-(2,3-dichlorophenyl)-N-phenylpropanamide (PubChem CID 38885504) has the molecular formula C15H13Cl2NO and a molecular weight of 294.18 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-phenylpropanamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 38885504 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-phenylpropanamide |
| SMILES | O=C(CCc1cccc(Cl)c1Cl)Nc1ccccc1 |
| InChI | InChI=1S/C15H13Cl2NO/c16-13-8-4-5-11(15(13)17)9-10-14(19)18-12-6-2-1-3-7-12/h1-8H,9-10H2,(H,18,19) |
| InChIKey | XKGRSOIMBPIHFI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |