C19H19Cl2NO — CID 38937319
3-(2,3-dichlorophenyl)-N-[(1-phenylcyclopropyl)methyl]propanamide (PubChem CID 38937319) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-[(1-phenylcyclopropyl)methyl]propanamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-[(1-phenylcyclopropyl)methyl]propanamide |
|---|---|
| PubChem CID | 38937319 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-[(1-phenylcyclopropyl)methyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1Cl)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19Cl2NO/c20-16-8-4-5-14(18(16)21)9-10-17(23)22-13-19(11-12-19)15-6-2-1-3-7-15/h1-8H,9-13H2,(H,22,23) |
| InChIKey | CFGPJKXXMVJCTL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |