C14H17NO2 — CID 110470652
3-oxo-N-[(1-phenylcyclopropyl)methyl]butanamide (PubChem CID 110470652) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-oxo-N-[(1-phenylcyclopropyl)methyl]butanamide.
| Compound Name | 3-oxo-N-[(1-phenylcyclopropyl)methyl]butanamide |
|---|---|
| PubChem CID | 110470652 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-oxo-N-[(1-phenylcyclopropyl)methyl]butanamide |
| SMILES | CC(=O)CC(=O)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H17NO2/c1-11(16)9-13(17)15-10-14(7-8-14)12-5-3-2-4-6-12/h2-6H,7-10H2,1H3,(H,15,17) |
| InChIKey | MEGARQXARKVQQX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|