C12H12F3NO — CID 110443182
2,2,2-trifluoro-N-[(1-phenylcyclopropyl)methyl]acetamide (PubChem CID 110443182) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1-phenylcyclopropyl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1-phenylcyclopropyl)methyl]acetamide |
|---|---|
| PubChem CID | 110443182 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1-phenylcyclopropyl)methyl]acetamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)10(17)16-8-11(6-7-11)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,16,17) |
| InChIKey | IAFYRNOUEKHTQA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |