C14H17NO3 — CID 110471120
ethyl 2-oxo-2-[(1-phenylcyclopropyl)methylamino]acetate (PubChem CID 110471120) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 2-oxo-2-[(1-phenylcyclopropyl)methylamino]acetate.
| Compound Name | ethyl 2-oxo-2-[(1-phenylcyclopropyl)methylamino]acetate |
|---|---|
| PubChem CID | 110471120 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 2-oxo-2-[(1-phenylcyclopropyl)methylamino]acetate |
| SMILES | CCOC(=O)C(=O)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H17NO3/c1-2-18-13(17)12(16)15-10-14(8-9-14)11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3,(H,15,16) |
| InChIKey | UFCSWURTCDCMET-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|