C23H29NO4 — CID 42145585
3,4,5-triethoxy-N-[(1-phenylcyclopropyl)methyl]benzamide (PubChem CID 42145585) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(1-phenylcyclopropyl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(1-phenylcyclopropyl)methyl]benzamide |
|---|---|
| PubChem CID | 42145585 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3,4,5-triethoxy-N-[(1-phenylcyclopropyl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCC2(c3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H29NO4/c1-4-26-19-14-17(15-20(27-5-2)21(19)28-6-3)22(25)24-16-23(12-13-23)18-10-8-7-9-11-18/h7-11,14-15H,4-6,12-13,16H2,1-3H3,(H,24,25) |
| InChIKey | AUZKOAYGFBYNEQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |