C19H29NO5S — CID 90584342
3,4,5-triethoxy-N-[(3-methoxythiolan-3-yl)methyl]benzamide (PubChem CID 90584342) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(3-methoxythiolan-3-yl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(3-methoxythiolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 90584342 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[(3-methoxythiolan-3-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCC2(OC)CCSC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H29NO5S/c1-5-23-15-10-14(11-16(24-6-2)17(15)25-7-3)18(21)20-12-19(22-4)8-9-26-13-19/h10-11H,5-9,12-13H2,1-4H3,(H,20,21) |
| InChIKey | OWJCFSPFQCEPRR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |