C21H28N2O4 — CID 119527990
N-(2-amino-2-phenylethyl)-3,4,5-triethoxybenzamide (PubChem CID 119527990) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(2-amino-2-phenylethyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 119527990 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCC(N)c2ccccc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H28N2O4/c1-4-25-18-12-16(13-19(26-5-2)20(18)27-6-3)21(24)23-14-17(22)15-10-8-7-9-11-15/h7-13,17H,4-6,14,22H2,1-3H3,(H,23,24) |
| InChIKey | WGVIJFQBJNYLCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |