C19H23N3O5 — CID 119527473
4-(2-amino-2-oxoethoxy)-N-(2-amino-2-phenylethyl)-3,5-dimethoxybenzamide (PubChem CID 119527473) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-(2-amino-2-phenylethyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-(2-amino-2-phenylethyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 119527473 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-(2-amino-2-phenylethyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(N)c2ccccc2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C19H23N3O5/c1-25-15-8-13(9-16(26-2)18(15)27-11-17(21)23)19(24)22-10-14(20)12-6-4-3-5-7-12/h3-9,14H,10-11,20H2,1-2H3,(H2,21,23)(H,22,24) |
| InChIKey | MOEIFXFTFRCUJZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |