C24H27NO4S — CID 8820643
3,4,5-triethoxy-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide (PubChem CID 8820643) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 8820643 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[(R)-phenyl(thiophen-2-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)N[C@H](c2ccccc2)c2cccs2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H27NO4S/c1-4-27-19-15-18(16-20(28-5-2)23(19)29-6-3)24(26)25-22(21-13-10-14-30-21)17-11-8-7-9-12-17/h7-16,22H,4-6H2,1-3H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | HTTODTHCSBMWRD-JOCHJYFZSA-N |
| XLogP | 5.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |