C23H25NO3S — CID 8853760
4-(2-ethoxyphenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]butanamide (PubChem CID 8853760) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 8853760 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H25NO3S/c1-2-26-19-12-6-7-13-20(19)27-16-8-15-22(25)24-23(21-14-9-17-28-21)18-10-4-3-5-11-18/h3-7,9-14,17,23H,2,8,15-16H2,1H3,(H,24,25)/t23-/m0/s1 |
| InChIKey | LZBFMENUKGDYFW-QHCPKHFHSA-N |
| XLogP | 5.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|