C24H22N2OS2 — CID 8866543
N-[(S)-phenyl(thiophen-2-yl)methyl]-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide (PubChem CID 8866543) has the molecular formula C24H22N2OS2 and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[(S)-phenyl(thiophen-2-yl)methyl]-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide.
| Compound Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 8866543 |
| Molecular Formula | C24H22N2OS2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]acetamide |
| SMILES | O=C(CN[C@@H](c1ccccc1)c1cccs1)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H22N2OS2/c27-22(26-24(21-14-8-16-29-21)19-11-5-2-6-12-19)17-25-23(20-13-7-15-28-20)18-9-3-1-4-10-18/h1-16,23-25H,17H2,(H,26,27)/t23-,24-/m0/s1 |
| InChIKey | XRETTWBKRJDKLG-ZEQRLZLVSA-N |
| XLogP | 5.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |