C20H19NOS2 — CID 9290006
2-benzylsulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 9290006) has the molecular formula C20H19NOS2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 9290006 |
| Molecular Formula | C20H19NOS2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-benzylsulfanyl-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(CSCc1ccccc1)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H19NOS2/c22-19(15-23-14-16-8-3-1-4-9-16)21-20(18-12-7-13-24-18)17-10-5-2-6-11-17/h1-13,20H,14-15H2,(H,21,22)/t20-/m0/s1 |
| InChIKey | VMIUBKJCLUVNJK-FQEVSTJZSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |