C19H17FN2OS2 — CID 55826845
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide (PubChem CID 55826845) has the molecular formula C19H17FN2OS2 and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55826845 |
| Molecular Formula | C19H17FN2OS2 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(pyridin-2-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1ccccn1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C19H17FN2OS2/c20-15-8-6-14(7-9-15)19(17-5-3-11-25-17)22-18(23)13-24-12-16-4-1-2-10-21-16/h1-11,19H,12-13H2,(H,22,23) |
| InChIKey | DGWYDLKDAQZZBW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |