C19H11F6NOS — CID 18279784
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 18279784) has the molecular formula C19H11F6NOS and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 18279784 |
| Molecular Formula | C19H11F6NOS |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C19H11F6NOS/c20-10-5-3-9(4-6-10)19(12-2-1-7-28-12)26-13(27)8-11-14(21)16(23)18(25)17(24)15(11)22/h1-7,19H,8H2,(H,26,27) |
| InChIKey | KHXUHJUKCWHXRN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|