C20H26FN2OS+ — CID 8680042
2-(azocan-1-ium-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 8680042) has the molecular formula C20H26FN2OS+ and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 8680042 |
| Molecular Formula | C20H26FN2OS+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-[(S)-(4-fluorophenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | O=C(C[NH+]1CCCCCCC1)N[C@@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C20H25FN2OS/c21-17-10-8-16(9-11-17)20(18-7-6-14-25-18)22-19(24)15-23-12-4-2-1-3-5-13-23/h6-11,14,20H,1-5,12-13,15H2,(H,22,24)/p+1/t20-/m0/s1 |
| InChIKey | NCVZXCCKNWNUGZ-FQEVSTJZSA-O |
| XLogP | 2.94 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |