C25H21FN2O2S — CID 46589785
N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]naphthalene-2-carboxamide (PubChem CID 46589785) has the molecular formula C25H21FN2O2S and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 46589785 |
| Molecular Formula | C25H21FN2O2S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]naphthalene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccc2ccccc2c1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C25H21FN2O2S/c26-21-11-9-18(10-12-21)24(22-6-3-15-31-22)28-23(29)13-14-27-25(30)20-8-7-17-4-1-2-5-19(17)16-20/h1-12,15-16,24H,13-14H2,(H,27,30)(H,28,29) |
| InChIKey | NACPLISKHZHWIT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |