C20H20N2O2S — CID 55569040
N-[3-oxo-3-(2-thiophen-2-ylethylamino)propyl]naphthalene-2-carboxamide (PubChem CID 55569040) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[3-oxo-3-(2-thiophen-2-ylethylamino)propyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-oxo-3-(2-thiophen-2-ylethylamino)propyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 55569040 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[3-oxo-3-(2-thiophen-2-ylethylamino)propyl]naphthalene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccc2ccccc2c1)NCCc1cccs1 |
| InChI | InChI=1S/C20H20N2O2S/c23-19(21-11-9-18-6-3-13-25-18)10-12-22-20(24)17-8-7-15-4-1-2-5-16(15)14-17/h1-8,13-14H,9-12H2,(H,21,23)(H,22,24) |
| InChIKey | YBDPLVDQLXCGDP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |