C13H13NOS2 — CID 107021162
4-sulfanyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 107021162) has the molecular formula C13H13NOS2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-sulfanyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-sulfanyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 107021162 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-sulfanyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1cccs1)c1ccc(S)cc1 |
| InChI | InChI=1S/C13H13NOS2/c15-13(10-3-5-11(16)6-4-10)14-8-7-12-2-1-9-17-12/h1-6,9,16H,7-8H2,(H,14,15) |
| InChIKey | NBLHQEHNLMDYJV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|