C12H12N2OS2 — CID 107029539
4-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 107029539) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 4-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107029539 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4-sulfanyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nccs1)c1ccc(S)cc1 |
| InChI | InChI=1S/C12H12N2OS2/c15-12(9-1-3-10(16)4-2-9)14-6-5-11-13-7-8-17-11/h1-4,7-8,16H,5-6H2,(H,14,15) |
| InChIKey | ABUZHWZAOZWABM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|