C10H9IN2OS2 — CID 78948417
5-iodo-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-3-carboxamide (PubChem CID 78948417) has the molecular formula C10H9IN2OS2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 5-iodo-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948417 |
| Molecular Formula | C10H9IN2OS2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 5-iodo-N-[2-(1,3-thiazol-2-yl)ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCc1nccs1)c1csc(I)c1 |
| InChI | InChI=1S/C10H9IN2OS2/c11-8-5-7(6-16-8)10(14)13-2-1-9-12-3-4-15-9/h3-6H,1-2H2,(H,13,14) |
| InChIKey | ZZAALZLUCLCZBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|