C11H10ClN3OS — CID 62186873
4-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide (PubChem CID 62186873) has the molecular formula C11H10ClN3OS and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62186873 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 4-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1nccs1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C11H10ClN3OS/c12-8-1-3-13-9(7-8)11(16)15-4-2-10-14-5-6-17-10/h1,3,5-7H,2,4H2,(H,15,16) |
| InChIKey | UGWMVGWVGJAQPL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |